C19H26N4O10 — CID 166711987
(4S)-5-[[(1S)-1-carboxyethyl]amino]-4-[[2-[[(2S)-3-carboxy-2-(pent-4-ynoylamino)propanoyl]amino]acetyl]amino]-5-oxopentanoic acid (PubChem CID 166711987) has the molecular formula C19H26N4O10 and a molecular weight of 470.44 g/mol. Its IUPAC name is (4S)-5-[[(1S)-1-carboxyethyl]amino]-4-[[2-[[(2S)-3-carboxy-2-(pent-4-ynoylamino)propanoyl]amino]acetyl]amino]-5-oxopentanoic acid.
| Compound Name | (4S)-5-[[(1S)-1-carboxyethyl]amino]-4-[[2-[[(2S)-3-carboxy-2-(pent-4-ynoylamino)propanoyl]amino]acetyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 166711987 |
| Molecular Formula | C19H26N4O10 |
| Molecular Weight | 470.44 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | (4S)-5-[[(1S)-1-carboxyethyl]amino]-4-[[2-[[(2S)-3-carboxy-2-(pent-4-ynoylamino)propanoyl]amino]acetyl]amino]-5-oxopentanoic acid |
| SMILES | C#CCCC(=O)N[C@@H](CC(=O)O)C(=O)NCC(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C19H26N4O10/c1-3-4-5-13(24)23-12(8-16(28)29)17(30)20-9-14(25)22-11(6-7-15(26)27)18(31)21-10(2)19(32)33/h1,10-12H,4-9H2,2H3,(H,20,30)(H,21,31)(H,22,25)(H,23,24)(H,26,27)(H,28,29)(H,32,33)/t10-,11-,12-/m0/s1 |
| InChIKey | BTAIYVYEZFYNFH-SRVKXCTJSA-N |
| XLogP | -2.59 |
| TPSA | 228.30 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.44 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|