C14H10F3N3 — CID 166716771
3-[6-amino-3-(trifluoromethyl)-2-pyridinyl]-4-methylbenzonitrile (PubChem CID 166716771) has the molecular formula C14H10F3N3 and a molecular weight of 277.25 g/mol. Its IUPAC name is 3-[6-amino-3-(trifluoromethyl)-2-pyridinyl]-4-methylbenzonitrile.
| Compound Name | 3-[6-amino-3-(trifluoromethyl)-2-pyridinyl]-4-methylbenzonitrile |
|---|---|
| PubChem CID | 166716771 |
| Molecular Formula | C14H10F3N3 |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 3-[6-amino-3-(trifluoromethyl)-2-pyridinyl]-4-methylbenzonitrile |
| SMILES | Cc1ccc(C#N)cc1-c1nc(N)ccc1C(F)(F)F |
| InChI | InChI=1S/C14H10F3N3/c1-8-2-3-9(7-18)6-10(8)13-11(14(15,16)17)4-5-12(19)20-13/h2-6H,1H3,(H2,19,20) |
| InChIKey | HQACMUZBJOWKKS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |