C32H52ClN5O7 — CID 166720618
ethyl 2-[[1-[(2S)-2-[[4-[N-(2-hexoxyethoxycarbonyl)carbamimidoyl]phenyl]methylcarbamoyl]pyrrolidin-1-yl]-4-methyl-1-oxopentan-2-yl]amino]acetate;hydrochloride (PubChem CID 166720618) has the molecular formula C32H52ClN5O7 and a molecular weight of 654.25 g/mol. Its IUPAC name is ethyl 2-[[1-[(2S)-2-[[4-[N-(2-hexoxyethoxycarbonyl)carbamimidoyl]phenyl]methylcarbamoyl]pyrrolidin-1-yl]-4-methyl-1-oxopentan-2-yl]amino]acetate;hydrochloride.
| Compound Name | ethyl 2-[[1-[(2S)-2-[[4-[N-(2-hexoxyethoxycarbonyl)carbamimidoyl]phenyl]methylcarbamoyl]pyrrolidin-1-yl]-4-methyl-1-oxopentan-2-yl]amino]acetate;hydrochloride |
|---|---|
| PubChem CID | 166720618 |
| Molecular Formula | C32H52ClN5O7 |
| Molecular Weight | 654.25 g/mol |
| Exact Mass | 653.36 |
| IUPAC Name | ethyl 2-[[1-[(2S)-2-[[4-[N-(2-hexoxyethoxycarbonyl)carbamimidoyl]phenyl]methylcarbamoyl]pyrrolidin-1-yl]-4-methyl-1-oxopentan-2-yl]amino]acetate;hydrochloride |
| SMILES | Cl.[H]/N=C(\NC(=O)OCCOCCCCCC)c1ccc(CNC(=O)[C@@H]2CCCN2C(=O)C(CC(C)C)NCC(=O)OCC)cc1 |
| InChI | InChI=1S/C32H51N5O7.ClH/c1-5-7-8-9-17-42-18-19-44-32(41)36-29(33)25-14-12-24(13-15-25)21-35-30(39)27-11-10-16-37(27)31(40)26(20-23(3)4)34-22-28(38)43-6-2;/h12-15,23,26-27,34H,5-11,16-22H2,1-4H3,(H,35,39)(H2,33,36,41);1H/t26?,27-;/m0./s1 |
| InChIKey | UCTFZJVCCUDQQS-LEUNPYLKSA-N |
| XLogP | 3.93 |
| TPSA | 159.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.25 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|