C27H29Cl2F5N4O3S — CID 166725340
(4R)-2-[4-[benzenesulfonyl-[(3,4-dichlorophenyl)methyl]amino]but-1-en-2-yl]-N,5,5-trimethyl-N-(2,2,3,3,3-pentafluoropropyl)-1,4-dihydroimidazole-4-carboxamide (PubChem CID 166725340) has the molecular formula C27H29Cl2F5N4O3S and a molecular weight of 655.52 g/mol. Its IUPAC name is (4R)-2-[4-[benzenesulfonyl-[(3,4-dichlorophenyl)methyl]amino]but-1-en-2-yl]-N,5,5-trimethyl-N-(2,2,3,3,3-pentafluoropropyl)-1,4-dihydroimidazole-4-carboxamide.
| Compound Name | (4R)-2-[4-[benzenesulfonyl-[(3,4-dichlorophenyl)methyl]amino]but-1-en-2-yl]-N,5,5-trimethyl-N-(2,2,3,3,3-pentafluoropropyl)-1,4-dihydroimidazole-4-carboxamide |
|---|---|
| PubChem CID | 166725340 |
| Molecular Formula | C27H29Cl2F5N4O3S |
| Molecular Weight | 655.52 g/mol |
| Exact Mass | 654.13 |
| IUPAC Name | (4R)-2-[4-[benzenesulfonyl-[(3,4-dichlorophenyl)methyl]amino]but-1-en-2-yl]-N,5,5-trimethyl-N-(2,2,3,3,3-pentafluoropropyl)-1,4-dihydroimidazole-4-carboxamide |
| SMILES | C=C(CCN(Cc1ccc(Cl)c(Cl)c1)S(=O)(=O)c1ccccc1)C1=N[C@@H](C(=O)N(C)CC(F)(F)C(F)(F)F)C(C)(C)N1 |
| InChI | InChI=1S/C27H29Cl2F5N4O3S/c1-17(23-35-22(25(2,3)36-23)24(39)37(4)16-26(30,31)27(32,33)34)12-13-38(15-18-10-11-20(28)21(29)14-18)42(40,41)19-8-6-5-7-9-19/h5-11,14,22H,1,12-13,15-16H2,2-4H3,(H,35,36)/t22-/m0/s1 |
| InChIKey | GSDVOHRHUTVKGW-QFIPXVFZSA-N |
| XLogP | 5.94 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.52 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|