About [7-(2-ethyl-1,3-dioxolan-2-yl)-1-hydrazinyl-1-oxoheptan-2-yl]carbamic acid
[7-(2-ethyl-1,3-dioxolan-2-yl)-1-hydrazinyl-1-oxoheptan-2-yl]carbamic acid (PubChem CID 166729437) has the molecular formula C13H25N3O5
and a molecular weight of 303.36 g/mol. Its IUPAC name is [7-(2-ethyl-1,3-dioxolan-2-yl)-1-hydrazinyl-1-oxoheptan-2-yl]carbamic acid.
Molecular Properties
| Compound Name | [7-(2-ethyl-1,3-dioxolan-2-yl)-1-hydrazinyl-1-oxoheptan-2-yl]carbamic acid |
| PubChem CID | 166729437 |
| Molecular Formula | C13H25N3O5 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | [7-(2-ethyl-1,3-dioxolan-2-yl)-1-hydrazinyl-1-oxoheptan-2-yl]carbamic acid |
| SMILES | CCC1(CCCCCC(NC(=O)O)C(=O)NN)OCCO1 |
| InChI | InChI=1S/C13H25N3O5/c1-2-13(20-8-9-21-13)7-5-3-4-6-10(11(17)16-14)15-12(18)19/h10,15H,2-9,14H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | XWZCCYZBSMSOIP-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [7-(2-ethyl-1,3-dioxolan-2-yl)-1-hydrazinyl-1-oxoheptan-2-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7-(2-ethyl-1,3-dioxolan-2-yl)-1-hydrazinyl-1-oxoheptan-2-yl]carbamic acid?
The IUPAC name of [7-(2-ethyl-1,3-dioxolan-2-yl)-1-hydrazinyl-1-oxoheptan-2-yl]carbamic acid (CID 166729437) is [7-(2-ethyl-1,3-dioxolan-2-yl)-1-hydrazinyl-1-oxoheptan-2-yl]carbamic acid.
What is the SMILES notation for [7-(2-ethyl-1,3-dioxolan-2-yl)-1-hydrazinyl-1-oxoheptan-2-yl]carbamic acid?
The canonical SMILES for [7-(2-ethyl-1,3-dioxolan-2-yl)-1-hydrazinyl-1-oxoheptan-2-yl]carbamic acid is CCC1(CCCCCC(NC(=O)O)C(=O)NN)OCCO1.
What is the InChIKey of [7-(2-ethyl-1,3-dioxolan-2-yl)-1-hydrazinyl-1-oxoheptan-2-yl]carbamic acid?
The InChIKey is XWZCCYZBSMSOIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N3O5/c1-2-13(20-8-9-21-13)7-5-3-4-6-10(11(17)16-14)15-12(18)19/h10,15H,2-9,14H2,1H3,(H,16,17)(H,18,19).
What are the key properties of [7-(2-ethyl-1,3-dioxolan-2-yl)-1-hydrazinyl-1-oxoheptan-2-yl]carbamic acid?
[7-(2-ethyl-1,3-dioxolan-2-yl)-1-hydrazinyl-1-oxoheptan-2-yl]carbamic acid has a molecular weight of 303.36 g/mol, XLogP of 0.72, 9 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [7-(2-ethyl-1,3-dioxolan-2-yl)-1-hydrazinyl-1-oxoheptan-2-yl]carbamic acid is sourced from PubChem (CID 166729437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).