C13H25N3O5 — CID 166729437
[7-(2-ethyl-1,3-dioxolan-2-yl)-1-hydrazinyl-1-oxoheptan-2-yl]carbamic acid (PubChem CID 166729437) has the molecular formula C13H25N3O5 and a molecular weight of 303.36 g/mol. Its IUPAC name is [7-(2-ethyl-1,3-dioxolan-2-yl)-1-hydrazinyl-1-oxoheptan-2-yl]carbamic acid.
| Compound Name | [7-(2-ethyl-1,3-dioxolan-2-yl)-1-hydrazinyl-1-oxoheptan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 166729437 |
| Molecular Formula | C13H25N3O5 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | [7-(2-ethyl-1,3-dioxolan-2-yl)-1-hydrazinyl-1-oxoheptan-2-yl]carbamic acid |
| SMILES | CCC1(CCCCCC(NC(=O)O)C(=O)NN)OCCO1 |
| InChI | InChI=1S/C13H25N3O5/c1-2-13(20-8-9-21-13)7-5-3-4-6-10(11(17)16-14)15-12(18)19/h10,15H,2-9,14H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | XWZCCYZBSMSOIP-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|