C20H18F3N5O2S — CID 166731762
(2S)-2-[3-[2-(prop-2-enoylamino)-1H-pyridazin-5-yl]phenyl]-N-[5-(trifluoromethyl)-1,3-thiazol-2-yl]propanamide (PubChem CID 166731762) has the molecular formula C20H18F3N5O2S and a molecular weight of 449.46 g/mol. Its IUPAC name is (2S)-2-[3-[2-(prop-2-enoylamino)-1H-pyridazin-5-yl]phenyl]-N-[5-(trifluoromethyl)-1,3-thiazol-2-yl]propanamide.
| Compound Name | (2S)-2-[3-[2-(prop-2-enoylamino)-1H-pyridazin-5-yl]phenyl]-N-[5-(trifluoromethyl)-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 166731762 |
| Molecular Formula | C20H18F3N5O2S |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | (2S)-2-[3-[2-(prop-2-enoylamino)-1H-pyridazin-5-yl]phenyl]-N-[5-(trifluoromethyl)-1,3-thiazol-2-yl]propanamide |
| SMILES | C=CC(=O)NN1C=CC(c2cccc([C@H](C)C(=O)Nc3ncc(C(F)(F)F)s3)c2)=CN1 |
| InChI | InChI=1S/C20H18F3N5O2S/c1-3-17(29)27-28-8-7-15(10-25-28)14-6-4-5-13(9-14)12(2)18(30)26-19-24-11-16(31-19)20(21,22)23/h3-12,25H,1H2,2H3,(H,27,29)(H,24,26,30)/t12-/m0/s1 |
| InChIKey | LRYCHPBUSNYOBR-LBPRGKRZSA-N |
| XLogP | 3.80 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|