C24H22N4O2S — CID 146448811
(2S)-2-[3-[3-cyano-4-(prop-2-enoylamino)phenyl]phenyl]-N-(5-ethyl-1,3-thiazol-2-yl)propanamide (PubChem CID 146448811) has the molecular formula C24H22N4O2S and a molecular weight of 430.53 g/mol. Its IUPAC name is (2S)-2-[3-[3-cyano-4-(prop-2-enoylamino)phenyl]phenyl]-N-(5-ethyl-1,3-thiazol-2-yl)propanamide.
| Compound Name | (2S)-2-[3-[3-cyano-4-(prop-2-enoylamino)phenyl]phenyl]-N-(5-ethyl-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 146448811 |
| Molecular Formula | C24H22N4O2S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | (2S)-2-[3-[3-cyano-4-(prop-2-enoylamino)phenyl]phenyl]-N-(5-ethyl-1,3-thiazol-2-yl)propanamide |
| SMILES | C=CC(=O)Nc1ccc(-c2cccc([C@H](C)C(=O)Nc3ncc(CC)s3)c2)cc1C#N |
| InChI | InChI=1S/C24H22N4O2S/c1-4-20-14-26-24(31-20)28-23(30)15(3)16-7-6-8-17(11-16)18-9-10-21(19(12-18)13-25)27-22(29)5-2/h5-12,14-15H,2,4H2,1,3H3,(H,27,29)(H,26,28,30)/t15-/m0/s1 |
| InChIKey | PLSQFUZNBFYSNP-HNNXBMFYSA-N |
| XLogP | 5.11 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|