C20H20N6O2S — CID 175839004
2-[5-[5-(3-amino-3-oxoprop-1-en-2-yl)pyrazin-2-yl]-3-pyridinyl]-N-(5-ethyl-1,3-thiazol-2-yl)propanamide (PubChem CID 175839004) has the molecular formula C20H20N6O2S and a molecular weight of 408.49 g/mol. Its IUPAC name is 2-[5-[5-(3-amino-3-oxoprop-1-en-2-yl)pyrazin-2-yl]-3-pyridinyl]-N-(5-ethyl-1,3-thiazol-2-yl)propanamide.
| Compound Name | 2-[5-[5-(3-amino-3-oxoprop-1-en-2-yl)pyrazin-2-yl]-3-pyridinyl]-N-(5-ethyl-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 175839004 |
| Molecular Formula | C20H20N6O2S |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 2-[5-[5-(3-amino-3-oxoprop-1-en-2-yl)pyrazin-2-yl]-3-pyridinyl]-N-(5-ethyl-1,3-thiazol-2-yl)propanamide |
| SMILES | C=C(C(N)=O)c1cnc(-c2cncc(C(C)C(=O)Nc3ncc(CC)s3)c2)cn1 |
| InChI | InChI=1S/C20H20N6O2S/c1-4-15-8-25-20(29-15)26-19(28)11(2)13-5-14(7-22-6-13)17-10-23-16(9-24-17)12(3)18(21)27/h5-11H,3-4H2,1-2H3,(H2,21,27)(H,25,26,28) |
| InChIKey | IHJDTGCFRIBWLC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 123.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|