C21H21N5O2S — CID 159348235
N-[5-[5-[4-(5-ethyl-1,3-thiazol-2-yl)-3-oxobutan-2-yl]-3-pyridinyl]pyrazin-2-yl]prop-2-enamide (PubChem CID 159348235) has the molecular formula C21H21N5O2S and a molecular weight of 407.50 g/mol. Its IUPAC name is N-[5-[5-[4-(5-ethyl-1,3-thiazol-2-yl)-3-oxobutan-2-yl]-3-pyridinyl]pyrazin-2-yl]prop-2-enamide.
| Compound Name | N-[5-[5-[4-(5-ethyl-1,3-thiazol-2-yl)-3-oxobutan-2-yl]-3-pyridinyl]pyrazin-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 159348235 |
| Molecular Formula | C21H21N5O2S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | N-[5-[5-[4-(5-ethyl-1,3-thiazol-2-yl)-3-oxobutan-2-yl]-3-pyridinyl]pyrazin-2-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cnc(-c2cncc(C(C)C(=O)Cc3ncc(CC)s3)c2)cn1 |
| InChI | InChI=1S/C21H21N5O2S/c1-4-16-10-25-21(29-16)7-18(27)13(3)14-6-15(9-22-8-14)17-11-24-19(12-23-17)26-20(28)5-2/h5-6,8-13H,2,4,7H2,1,3H3,(H,24,26,28) |
| InChIKey | LGZOOEXUOLWFQW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 97.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|