About N-(5-cyano-1,3-thiazol-2-yl)-2-[3-[6-(prop-2-enoylamino)pyrazin-2-yl]phenyl]propanamide
N-(5-cyano-1,3-thiazol-2-yl)-2-[3-[6-(prop-2-enoylamino)pyrazin-2-yl]phenyl]propanamide (PubChem CID 146448996) has the molecular formula C20H16N6O2S
and a molecular weight of 404.46 g/mol. Its IUPAC name is N-(5-cyano-1,3-thiazol-2-yl)-2-[3-[6-(prop-2-enoylamino)pyrazin-2-yl]phenyl]propanamide.
Molecular Properties
| Compound Name | N-(5-cyano-1,3-thiazol-2-yl)-2-[3-[6-(prop-2-enoylamino)pyrazin-2-yl]phenyl]propanamide |
| PubChem CID | 146448996 |
| Molecular Formula | C20H16N6O2S |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | N-(5-cyano-1,3-thiazol-2-yl)-2-[3-[6-(prop-2-enoylamino)pyrazin-2-yl]phenyl]propanamide |
| SMILES | C=CC(=O)Nc1cncc(-c2cccc(C(C)C(=O)Nc3ncc(C#N)s3)c2)n1 |
| InChI | InChI=1S/C20H16N6O2S/c1-3-18(27)25-17-11-22-10-16(24-17)14-6-4-5-13(7-14)12(2)19(28)26-20-23-9-15(8-21)29-20/h3-7,9-12H,1H2,2H3,(H,23,26,28)(H,24,25,27) |
| InChIKey | UUZWMMCGVFKHNI-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-(5-cyano-1,3-thiazol-2-yl)-2-[3-[6-(prop-2-enoylamino)pyrazin-2-yl]phenyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-cyano-1,3-thiazol-2-yl)-2-[3-[6-(prop-2-enoylamino)pyrazin-2-yl]phenyl]propanamide?
The IUPAC name of N-(5-cyano-1,3-thiazol-2-yl)-2-[3-[6-(prop-2-enoylamino)pyrazin-2-yl]phenyl]propanamide (CID 146448996) is N-(5-cyano-1,3-thiazol-2-yl)-2-[3-[6-(prop-2-enoylamino)pyrazin-2-yl]phenyl]propanamide.
What is the SMILES notation for N-(5-cyano-1,3-thiazol-2-yl)-2-[3-[6-(prop-2-enoylamino)pyrazin-2-yl]phenyl]propanamide?
The canonical SMILES for N-(5-cyano-1,3-thiazol-2-yl)-2-[3-[6-(prop-2-enoylamino)pyrazin-2-yl]phenyl]propanamide is C=CC(=O)Nc1cncc(-c2cccc(C(C)C(=O)Nc3ncc(C#N)s3)c2)n1.
What is the InChIKey of N-(5-cyano-1,3-thiazol-2-yl)-2-[3-[6-(prop-2-enoylamino)pyrazin-2-yl]phenyl]propanamide?
The InChIKey is UUZWMMCGVFKHNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N6O2S/c1-3-18(27)25-17-11-22-10-16(24-17)14-6-4-5-13(7-14)12(2)19(28)26-20-23-9-15(8-21)29-20/h3-7,9-12H,1H2,2H3,(H,23,26,28)(H,24,25,27).
What are the key properties of N-(5-cyano-1,3-thiazol-2-yl)-2-[3-[6-(prop-2-enoylamino)pyrazin-2-yl]phenyl]propanamide?
N-(5-cyano-1,3-thiazol-2-yl)-2-[3-[6-(prop-2-enoylamino)pyrazin-2-yl]phenyl]propanamide has a molecular weight of 404.46 g/mol, XLogP of 3.34, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-cyano-1,3-thiazol-2-yl)-2-[3-[6-(prop-2-enoylamino)pyrazin-2-yl]phenyl]propanamide is sourced from PubChem (CID 146448996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).