About 2-[2-(hydroxymethyl)-1,3-dioxan-5-yl]acetamide
2-[2-(hydroxymethyl)-1,3-dioxan-5-yl]acetamide (PubChem CID 166732225) has the molecular formula C7H13NO4
and a molecular weight of 175.18 g/mol. Its IUPAC name is 2-[2-(hydroxymethyl)-1,3-dioxan-5-yl]acetamide.
Molecular Properties
| Compound Name | 2-[2-(hydroxymethyl)-1,3-dioxan-5-yl]acetamide |
| PubChem CID | 166732225 |
| Molecular Formula | C7H13NO4 |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | 2-[2-(hydroxymethyl)-1,3-dioxan-5-yl]acetamide |
| SMILES | NC(=O)CC1COC(CO)OC1 |
| InChI | InChI=1S/C7H13NO4/c8-6(10)1-5-3-11-7(2-9)12-4-5/h5,7,9H,1-4H2,(H2,8,10) |
| InChIKey | DWGRPQKNGHMEIY-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(hydroxymethyl)-1,3-dioxan-5-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(hydroxymethyl)-1,3-dioxan-5-yl]acetamide?
The IUPAC name of 2-[2-(hydroxymethyl)-1,3-dioxan-5-yl]acetamide (CID 166732225) is 2-[2-(hydroxymethyl)-1,3-dioxan-5-yl]acetamide.
What is the SMILES notation for 2-[2-(hydroxymethyl)-1,3-dioxan-5-yl]acetamide?
The canonical SMILES for 2-[2-(hydroxymethyl)-1,3-dioxan-5-yl]acetamide is NC(=O)CC1COC(CO)OC1.
What is the InChIKey of 2-[2-(hydroxymethyl)-1,3-dioxan-5-yl]acetamide?
The InChIKey is DWGRPQKNGHMEIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO4/c8-6(10)1-5-3-11-7(2-9)12-4-5/h5,7,9H,1-4H2,(H2,8,10).
What are the key properties of 2-[2-(hydroxymethyl)-1,3-dioxan-5-yl]acetamide?
2-[2-(hydroxymethyl)-1,3-dioxan-5-yl]acetamide has a molecular weight of 175.18 g/mol, XLogP of -1.16, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(hydroxymethyl)-1,3-dioxan-5-yl]acetamide is sourced from PubChem (CID 166732225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).