C7H13NO4 — CID 166732225
2-[2-(hydroxymethyl)-1,3-dioxan-5-yl]acetamide (PubChem CID 166732225) has the molecular formula C7H13NO4 and a molecular weight of 175.18 g/mol. Its IUPAC name is 2-[2-(hydroxymethyl)-1,3-dioxan-5-yl]acetamide.
| Compound Name | 2-[2-(hydroxymethyl)-1,3-dioxan-5-yl]acetamide |
|---|---|
| PubChem CID | 166732225 |
| Molecular Formula | C7H13NO4 |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | 2-[2-(hydroxymethyl)-1,3-dioxan-5-yl]acetamide |
| SMILES | NC(=O)CC1COC(CO)OC1 |
| InChI | InChI=1S/C7H13NO4/c8-6(10)1-5-3-11-7(2-9)12-4-5/h5,7,9H,1-4H2,(H2,8,10) |
| InChIKey | DWGRPQKNGHMEIY-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |