C38H21F2NO2 — CID 166733033
5,6-difluoro-2-[[3-(N-phenylanilino)fluoranthen-8-yl]methylidene]indene-1,3-dione (PubChem CID 166733033) has the molecular formula C38H21F2NO2 and a molecular weight of 561.59 g/mol. Its IUPAC name is 5,6-difluoro-2-[[3-(N-phenylanilino)fluoranthen-8-yl]methylidene]indene-1,3-dione.
| Compound Name | 5,6-difluoro-2-[[3-(N-phenylanilino)fluoranthen-8-yl]methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 166733033 |
| Molecular Formula | C38H21F2NO2 |
| Molecular Weight | 561.59 g/mol |
| Exact Mass | 561.15 |
| IUPAC Name | 5,6-difluoro-2-[[3-(N-phenylanilino)fluoranthen-8-yl]methylidene]indene-1,3-dione |
| SMILES | O=C1C(=Cc2ccc3c(c2)-c2cccc4c(N(c5ccccc5)c5ccccc5)ccc-3c24)C(=O)c2cc(F)c(F)cc21 |
| InChI | InChI=1S/C38H21F2NO2/c39-33-20-30-31(21-34(33)40)38(43)32(37(30)42)19-22-14-15-25-27-16-17-35(28-13-7-12-26(36(27)28)29(25)18-22)41(23-8-3-1-4-9-23)24-10-5-2-6-11-24/h1-21H |
| InChIKey | IGCDKJKWQULHCM-UHFFFAOYSA-N |
| XLogP | 9.70 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.59 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|