C9H21N3S — CID 166733208
1-ethyl-1,2,3-trimethyl-3-(2-methylsulfanylethyl)guanidine (PubChem CID 166733208) has the molecular formula C9H21N3S and a molecular weight of 203.35 g/mol. Its IUPAC name is 1-ethyl-1,2,3-trimethyl-3-(2-methylsulfanylethyl)guanidine.
| Compound Name | 1-ethyl-1,2,3-trimethyl-3-(2-methylsulfanylethyl)guanidine |
|---|---|
| PubChem CID | 166733208 |
| Molecular Formula | C9H21N3S |
| Molecular Weight | 203.35 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | 1-ethyl-1,2,3-trimethyl-3-(2-methylsulfanylethyl)guanidine |
| SMILES | CCN(C)/C(=N\C)N(C)CCSC |
| InChI | InChI=1S/C9H21N3S/c1-6-11(3)9(10-2)12(4)7-8-13-5/h6-8H2,1-5H3/b10-9+ |
| InChIKey | OFTJRWFSVQZAAD-MDZDMXLPSA-N |
| XLogP | 1.22 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.35 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|