C24H40O3 — CID 166739782
methyl 4-[3-(2,6-dimethylphenoxy)propyl]-3-methylundecanoate (PubChem CID 166739782) has the molecular formula C24H40O3 and a molecular weight of 376.58 g/mol. Its IUPAC name is methyl 4-[3-(2,6-dimethylphenoxy)propyl]-3-methylundecanoate.
| Compound Name | methyl 4-[3-(2,6-dimethylphenoxy)propyl]-3-methylundecanoate |
|---|---|
| PubChem CID | 166739782 |
| Molecular Formula | C24H40O3 |
| Molecular Weight | 376.58 g/mol |
| Exact Mass | 376.30 |
| IUPAC Name | methyl 4-[3-(2,6-dimethylphenoxy)propyl]-3-methylundecanoate |
| SMILES | CCCCCCCC(CCCOc1c(C)cccc1C)C(C)CC(=O)OC |
| InChI | InChI=1S/C24H40O3/c1-6-7-8-9-10-15-22(21(4)18-23(25)26-5)16-12-17-27-24-19(2)13-11-14-20(24)3/h11,13-14,21-22H,6-10,12,15-18H2,1-5H3 |
| InChIKey | VWAOVOCBMPEWPG-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.58 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|