C46H35N3O2 — CID 166744297
3-(8-dibenzofuran-1-yl-5a,6,7,9a-tetrahydrodibenzofuran-4-yl)-N'-[C-phenyl-N-(1-phenylethenyl)carbonimidoyl]benzenecarboximidamide (PubChem CID 166744297) has the molecular formula C46H35N3O2 and a molecular weight of 661.81 g/mol. Its IUPAC name is 3-(8-dibenzofuran-1-yl-5a,6,7,9a-tetrahydrodibenzofuran-4-yl)-N'-[C-phenyl-N-(1-phenylethenyl)carbonimidoyl]benzenecarboximidamide.
| Compound Name | 3-(8-dibenzofuran-1-yl-5a,6,7,9a-tetrahydrodibenzofuran-4-yl)-N'-[C-phenyl-N-(1-phenylethenyl)carbonimidoyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 166744297 |
| Molecular Formula | C46H35N3O2 |
| Molecular Weight | 661.81 g/mol |
| Exact Mass | 661.27 |
| IUPAC Name | 3-(8-dibenzofuran-1-yl-5a,6,7,9a-tetrahydrodibenzofuran-4-yl)-N'-[C-phenyl-N-(1-phenylethenyl)carbonimidoyl]benzenecarboximidamide |
| SMILES | C=C(/N=C(/N=C(\N)c1cccc(-c2cccc3c2OC2CCC(c4cccc5oc6ccccc6c45)=CC32)c1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C46H35N3O2/c1-29(30-13-4-2-5-14-30)48-46(31-15-6-3-7-16-31)49-45(47)34-18-10-17-32(27-34)36-21-11-22-37-39-28-33(25-26-41(39)51-44(36)37)35-20-12-24-42-43(35)38-19-8-9-23-40(38)50-42/h2-24,27-28,39,41H,1,25-26H2,(H2,47,48,49) |
| InChIKey | JQQPZXKRARCEHI-UHFFFAOYSA-N |
| XLogP | 10.80 |
| TPSA | 73.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.81 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|