C16H28N4O5 — CID 166748544
[3-cyclohexyl-1-[[1-(dimethylcarbamoylamino)-3-oxopropan-2-yl]amino]-1-oxopropan-2-yl]carbamic acid (PubChem CID 166748544) has the molecular formula C16H28N4O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is [3-cyclohexyl-1-[[1-(dimethylcarbamoylamino)-3-oxopropan-2-yl]amino]-1-oxopropan-2-yl]carbamic acid.
| Compound Name | [3-cyclohexyl-1-[[1-(dimethylcarbamoylamino)-3-oxopropan-2-yl]amino]-1-oxopropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 166748544 |
| Molecular Formula | C16H28N4O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | [3-cyclohexyl-1-[[1-(dimethylcarbamoylamino)-3-oxopropan-2-yl]amino]-1-oxopropan-2-yl]carbamic acid |
| SMILES | CN(C)C(=O)NCC(C=O)NC(=O)C(CC1CCCCC1)NC(=O)O |
| InChI | InChI=1S/C16H28N4O5/c1-20(2)15(23)17-9-12(10-21)18-14(22)13(19-16(24)25)8-11-6-4-3-5-7-11/h10-13,19H,3-9H2,1-2H3,(H,17,23)(H,18,22)(H,24,25) |
| InChIKey | BFAKWGGIADNWRB-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|