C16H31N3O3 — CID 69468804
[(2R)-2-[tert-butylcarbamoyl(methyl)amino]-3-cyclohexylpropyl]carbamic acid (PubChem CID 69468804) has the molecular formula C16H31N3O3 and a molecular weight of 313.44 g/mol. Its IUPAC name is [(2R)-2-[tert-butylcarbamoyl(methyl)amino]-3-cyclohexylpropyl]carbamic acid.
| Compound Name | [(2R)-2-[tert-butylcarbamoyl(methyl)amino]-3-cyclohexylpropyl]carbamic acid |
|---|---|
| PubChem CID | 69468804 |
| Molecular Formula | C16H31N3O3 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | [(2R)-2-[tert-butylcarbamoyl(methyl)amino]-3-cyclohexylpropyl]carbamic acid |
| SMILES | CN(C(=O)NC(C)(C)C)[C@@H](CNC(=O)O)CC1CCCCC1 |
| InChI | InChI=1S/C16H31N3O3/c1-16(2,3)18-14(20)19(4)13(11-17-15(21)22)10-12-8-6-5-7-9-12/h12-13,17H,5-11H2,1-4H3,(H,18,20)(H,21,22)/t13-/m1/s1 |
| InChIKey | AGBRXLVNSVXLBT-CYBMUJFWSA-N |
| XLogP | 3.03 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |