About 1,3-dicyclopentyl-N,N-dimethylpropan-2-amine
1,3-dicyclopentyl-N,N-dimethylpropan-2-amine (PubChem CID 58122659) has the molecular formula C15H29N
and a molecular weight of 223.40 g/mol. Its IUPAC name is 1,3-dicyclopentyl-N,N-dimethylpropan-2-amine.
Molecular Properties
| Compound Name | 1,3-dicyclopentyl-N,N-dimethylpropan-2-amine |
| PubChem CID | 58122659 |
| Molecular Formula | C15H29N |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.23 |
| IUPAC Name | 1,3-dicyclopentyl-N,N-dimethylpropan-2-amine |
| SMILES | CN(C)C(CC1CCCC1)CC1CCCC1 |
| InChI | InChI=1S/C15H29N/c1-16(2)15(11-13-7-3-4-8-13)12-14-9-5-6-10-14/h13-15H,3-12H2,1-2H3 |
| InChIKey | UELZDHBHURUXRB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,3-dicyclopentyl-N,N-dimethylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dicyclopentyl-N,N-dimethylpropan-2-amine?
The IUPAC name of 1,3-dicyclopentyl-N,N-dimethylpropan-2-amine (CID 58122659) is 1,3-dicyclopentyl-N,N-dimethylpropan-2-amine.
What is the SMILES notation for 1,3-dicyclopentyl-N,N-dimethylpropan-2-amine?
The canonical SMILES for 1,3-dicyclopentyl-N,N-dimethylpropan-2-amine is CN(C)C(CC1CCCC1)CC1CCCC1.
What is the InChIKey of 1,3-dicyclopentyl-N,N-dimethylpropan-2-amine?
The InChIKey is UELZDHBHURUXRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29N/c1-16(2)15(11-13-7-3-4-8-13)12-14-9-5-6-10-14/h13-15H,3-12H2,1-2H3.
What are the key properties of 1,3-dicyclopentyl-N,N-dimethylpropan-2-amine?
1,3-dicyclopentyl-N,N-dimethylpropan-2-amine has a molecular weight of 223.40 g/mol, XLogP of 4.08, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dicyclopentyl-N,N-dimethylpropan-2-amine is sourced from PubChem (CID 58122659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).