C32H44N2O8S — CID 166752107
[(4S,7R,8R)-8-ethyl-6,10-dioxatricyclo[5.2.1.04,8]decan-2-yl] N-[(2S,3R)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]carbamate (PubChem CID 166752107) has the molecular formula C32H44N2O8S and a molecular weight of 616.78 g/mol. Its IUPAC name is [(4S,7R,8R)-8-ethyl-6,10-dioxatricyclo[5.2.1.04,8]decan-2-yl] N-[(2S,3R)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]carbamate.
| Compound Name | [(4S,7R,8R)-8-ethyl-6,10-dioxatricyclo[5.2.1.04,8]decan-2-yl] N-[(2S,3R)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 166752107 |
| Molecular Formula | C32H44N2O8S |
| Molecular Weight | 616.78 g/mol |
| Exact Mass | 616.28 |
| IUPAC Name | [(4S,7R,8R)-8-ethyl-6,10-dioxatricyclo[5.2.1.04,8]decan-2-yl] N-[(2S,3R)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]carbamate |
| SMILES | CC[C@]12CC3O[C@H]1OC[C@H]2CC3OC(=O)N[C@@H](Cc1ccccc1)[C@H](O)CN(CC(C)C)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C32H44N2O8S/c1-5-32-17-29-28(16-23(32)20-40-30(32)41-29)42-31(36)33-26(15-22-9-7-6-8-10-22)27(35)19-34(18-21(2)3)43(37,38)25-13-11-24(39-4)12-14-25/h6-14,21,23,26-30,35H,5,15-20H2,1-4H3,(H,33,36)/t23-,26+,27-,28?,29?,30-,32-/m1/s1 |
| InChIKey | OFGCOCQBFIQVCE-FLNCSFNISA-N |
| XLogP | 3.97 |
| TPSA | 123.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.78 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |