C27H28N5O5S- — CID 166752238
2-[3-(3-amino-2-propan-2-yl-4-pyridinyl)butoxy]-5-[(5-phenyl-1,3-oxazole-2-carbonyl)amino]pyridine-3-sulfinate (PubChem CID 166752238) has the molecular formula C27H28N5O5S- and a molecular weight of 534.62 g/mol. Its IUPAC name is 2-[3-(3-amino-2-propan-2-yl-4-pyridinyl)butoxy]-5-[(5-phenyl-1,3-oxazole-2-carbonyl)amino]pyridine-3-sulfinate.
| Compound Name | 2-[3-(3-amino-2-propan-2-yl-4-pyridinyl)butoxy]-5-[(5-phenyl-1,3-oxazole-2-carbonyl)amino]pyridine-3-sulfinate |
|---|---|
| PubChem CID | 166752238 |
| Molecular Formula | C27H28N5O5S- |
| Molecular Weight | 534.62 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | 2-[3-(3-amino-2-propan-2-yl-4-pyridinyl)butoxy]-5-[(5-phenyl-1,3-oxazole-2-carbonyl)amino]pyridine-3-sulfinate |
| SMILES | CC(C)c1nccc(C(C)CCOc2ncc(NC(=O)c3ncc(-c4ccccc4)o3)cc2S(=O)[O-])c1N |
| InChI | InChI=1S/C27H29N5O5S/c1-16(2)24-23(28)20(9-11-29-24)17(3)10-12-36-26-22(38(34)35)13-19(14-30-26)32-25(33)27-31-15-21(37-27)18-7-5-4-6-8-18/h4-9,11,13-17H,10,12,28H2,1-3H3,(H,32,33)(H,34,35)/p-1 |
| InChIKey | BWAJGRQHDYBQBM-UHFFFAOYSA-M |
| XLogP | 4.90 |
| TPSA | 156.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.62 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|