C16H12N3O5S- — CID 166752460
2-methoxy-5-[(2-phenyl-1,3-oxazole-4-carbonyl)amino]pyridine-3-sulfinate (PubChem CID 166752460) has the molecular formula C16H12N3O5S- and a molecular weight of 358.36 g/mol. Its IUPAC name is 2-methoxy-5-[(2-phenyl-1,3-oxazole-4-carbonyl)amino]pyridine-3-sulfinate.
| Compound Name | 2-methoxy-5-[(2-phenyl-1,3-oxazole-4-carbonyl)amino]pyridine-3-sulfinate |
|---|---|
| PubChem CID | 166752460 |
| Molecular Formula | C16H12N3O5S- |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | 2-methoxy-5-[(2-phenyl-1,3-oxazole-4-carbonyl)amino]pyridine-3-sulfinate |
| SMILES | COc1ncc(NC(=O)c2coc(-c3ccccc3)n2)cc1S(=O)[O-] |
| InChI | InChI=1S/C16H13N3O5S/c1-23-16-13(25(21)22)7-11(8-17-16)18-14(20)12-9-24-15(19-12)10-5-3-2-4-6-10/h2-9H,1H3,(H,18,20)(H,21,22)/p-1 |
| InChIKey | PMDDFOYLIZFUMQ-UHFFFAOYSA-M |
| XLogP | 2.24 |
| TPSA | 117.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|