C26H28N8O2 — CID 166755559
N'-[[4-[4-amino-5-(4-phenoxyphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]-1-hydroxycyclohexyl]methyl]-N-hydrazinylidenemethanimidamide (PubChem CID 166755559) has the molecular formula C26H28N8O2 and a molecular weight of 484.56 g/mol. Its IUPAC name is N'-[[4-[4-amino-5-(4-phenoxyphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]-1-hydroxycyclohexyl]methyl]-N-hydrazinylidenemethanimidamide.
| Compound Name | N'-[[4-[4-amino-5-(4-phenoxyphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]-1-hydroxycyclohexyl]methyl]-N-hydrazinylidenemethanimidamide |
|---|---|
| PubChem CID | 166755559 |
| Molecular Formula | C26H28N8O2 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | N'-[[4-[4-amino-5-(4-phenoxyphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]-1-hydroxycyclohexyl]methyl]-N-hydrazinylidenemethanimidamide |
| SMILES | N/N=N/C=N/CC1(O)CCC(n2cc(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc32)CC1 |
| InChI | InChI=1S/C26H28N8O2/c27-24-23-22(18-6-8-21(9-7-18)36-20-4-2-1-3-5-20)14-34(25(23)31-17-30-24)19-10-12-26(35,13-11-19)15-29-16-32-33-28/h1-9,14,16-17,19,35H,10-13,15H2,(H2,27,30,31)(H2,28,29,32) |
| InChIKey | YSLIIYGJDHUULQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 149.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|