C25H23F3N2OS — CID 166755866
N-(3-benzhydrylidenepiperidin-1-yl)sulfanyl-4-(trifluoromethoxy)aniline (PubChem CID 166755866) has the molecular formula C25H23F3N2OS and a molecular weight of 456.53 g/mol. Its IUPAC name is N-(3-benzhydrylidenepiperidin-1-yl)sulfanyl-4-(trifluoromethoxy)aniline.
| Compound Name | N-(3-benzhydrylidenepiperidin-1-yl)sulfanyl-4-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 166755866 |
| Molecular Formula | C25H23F3N2OS |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | N-(3-benzhydrylidenepiperidin-1-yl)sulfanyl-4-(trifluoromethoxy)aniline |
| SMILES | FC(F)(F)Oc1ccc(NSN2CCCC(=C(c3ccccc3)c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C25H23F3N2OS/c26-25(27,28)31-23-15-13-22(14-16-23)29-32-30-17-7-12-21(18-30)24(19-8-3-1-4-9-19)20-10-5-2-6-11-20/h1-6,8-11,13-16,29H,7,12,17-18H2 |
| InChIKey | YNKHFJSZUZIJLR-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|