C24H21F5N2O2S — CID 166755879
N-[2-[bis(4-fluorophenyl)methyl]morpholin-4-yl]sulfanyl-4-(trifluoromethoxy)aniline (PubChem CID 166755879) has the molecular formula C24H21F5N2O2S and a molecular weight of 496.50 g/mol. Its IUPAC name is N-[2-[bis(4-fluorophenyl)methyl]morpholin-4-yl]sulfanyl-4-(trifluoromethoxy)aniline.
| Compound Name | N-[2-[bis(4-fluorophenyl)methyl]morpholin-4-yl]sulfanyl-4-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 166755879 |
| Molecular Formula | C24H21F5N2O2S |
| Molecular Weight | 496.50 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | N-[2-[bis(4-fluorophenyl)methyl]morpholin-4-yl]sulfanyl-4-(trifluoromethoxy)aniline |
| SMILES | Fc1ccc(C(c2ccc(F)cc2)C2CN(SNc3ccc(OC(F)(F)F)cc3)CCO2)cc1 |
| InChI | InChI=1S/C24H21F5N2O2S/c25-18-5-1-16(2-6-18)23(17-3-7-19(26)8-4-17)22-15-31(13-14-32-22)34-30-20-9-11-21(12-10-20)33-24(27,28)29/h1-12,22-23,30H,13-15H2 |
| InChIKey | OACPQZJRMPXOKG-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.50 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|