C26H23F5N4O3 — CID 174063897
3-[bis(4-fluorophenyl)methyl]-N'-nitro-N-[4-(trifluoromethoxy)phenyl]piperidine-1-carboximidamide (PubChem CID 174063897) has the molecular formula C26H23F5N4O3 and a molecular weight of 534.49 g/mol. Its IUPAC name is 3-[bis(4-fluorophenyl)methyl]-N'-nitro-N-[4-(trifluoromethoxy)phenyl]piperidine-1-carboximidamide.
| Compound Name | 3-[bis(4-fluorophenyl)methyl]-N'-nitro-N-[4-(trifluoromethoxy)phenyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 174063897 |
| Molecular Formula | C26H23F5N4O3 |
| Molecular Weight | 534.49 g/mol |
| Exact Mass | 534.17 |
| IUPAC Name | 3-[bis(4-fluorophenyl)methyl]-N'-nitro-N-[4-(trifluoromethoxy)phenyl]piperidine-1-carboximidamide |
| SMILES | O=[N+]([O-])N=C(Nc1ccc(OC(F)(F)F)cc1)N1CCCC(C(c2ccc(F)cc2)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C26H23F5N4O3/c27-20-7-3-17(4-8-20)24(18-5-9-21(28)10-6-18)19-2-1-15-34(16-19)25(33-35(36)37)32-22-11-13-23(14-12-22)38-26(29,30)31/h3-14,19,24H,1-2,15-16H2,(H,32,33) |
| InChIKey | BKMAYMMJGSLELV-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.49 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|