C21H19F4N3O3 — CID 71041310
(3aS,7aR)-N-(4-fluorophenyl)-4-oxo-5-[4-(trifluoromethoxy)phenyl]-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridine-2-carboxamide (PubChem CID 71041310) has the molecular formula C21H19F4N3O3 and a molecular weight of 437.39 g/mol. Its IUPAC name is (3aS,7aR)-N-(4-fluorophenyl)-4-oxo-5-[4-(trifluoromethoxy)phenyl]-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridine-2-carboxamide.
| Compound Name | (3aS,7aR)-N-(4-fluorophenyl)-4-oxo-5-[4-(trifluoromethoxy)phenyl]-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 71041310 |
| Molecular Formula | C21H19F4N3O3 |
| Molecular Weight | 437.39 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | (3aS,7aR)-N-(4-fluorophenyl)-4-oxo-5-[4-(trifluoromethoxy)phenyl]-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridine-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)N1C[C@@H]2CCN(c3ccc(OC(F)(F)F)cc3)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C21H19F4N3O3/c22-14-1-3-15(4-2-14)26-20(30)27-11-13-9-10-28(19(29)18(13)12-27)16-5-7-17(8-6-16)31-21(23,24)25/h1-8,13,18H,9-12H2,(H,26,30)/t13-,18+/m0/s1 |
| InChIKey | RPGIAZHLHQUFBN-SCLBCKFNSA-N |
| XLogP | 4.24 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |