C13H14ClF3N2O2 — CID 131730791
5-[4-(trifluoromethoxy)phenyl]-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-4-one;hydrochloride (PubChem CID 131730791) has the molecular formula C13H14ClF3N2O2 and a molecular weight of 322.71 g/mol. Its IUPAC name is 5-[4-(trifluoromethoxy)phenyl]-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-4-one;hydrochloride.
| Compound Name | 5-[4-(trifluoromethoxy)phenyl]-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-4-one;hydrochloride |
|---|---|
| PubChem CID | 131730791 |
| Molecular Formula | C13H14ClF3N2O2 |
| Molecular Weight | 322.71 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 5-[4-(trifluoromethoxy)phenyl]-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-4-one;hydrochloride |
| SMILES | Cl.O=C1C2CNCC2CN1c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H13F3N2O2.ClH/c14-13(15,16)20-10-3-1-9(2-4-10)18-7-8-5-17-6-11(8)12(18)19;/h1-4,8,11,17H,5-7H2;1H |
| InChIKey | JKQWXWKOYIRNPH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.71 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |