C21H24IN3O3 — CID 166757555
5-(4-iodophenyl)-3-[[4-methyl-2-[1-(oxan-2-yloxy)ethyl]imidazol-1-yl]methyl]-1,2-oxazole (PubChem CID 166757555) has the molecular formula C21H24IN3O3 and a molecular weight of 493.35 g/mol. Its IUPAC name is 5-(4-iodophenyl)-3-[[4-methyl-2-[1-(oxan-2-yloxy)ethyl]imidazol-1-yl]methyl]-1,2-oxazole.
| Compound Name | 5-(4-iodophenyl)-3-[[4-methyl-2-[1-(oxan-2-yloxy)ethyl]imidazol-1-yl]methyl]-1,2-oxazole |
|---|---|
| PubChem CID | 166757555 |
| Molecular Formula | C21H24IN3O3 |
| Molecular Weight | 493.35 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | 5-(4-iodophenyl)-3-[[4-methyl-2-[1-(oxan-2-yloxy)ethyl]imidazol-1-yl]methyl]-1,2-oxazole |
| SMILES | Cc1cn(Cc2cc(-c3ccc(I)cc3)on2)c(C(C)OC2CCCCO2)n1 |
| InChI | InChI=1S/C21H24IN3O3/c1-14-12-25(21(23-14)15(2)27-20-5-3-4-10-26-20)13-18-11-19(28-24-18)16-6-8-17(22)9-7-16/h6-9,11-12,15,20H,3-5,10,13H2,1-2H3 |
| InChIKey | OVDGMOXWHJAIAP-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 62.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.35 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|