C26H34ClFO4 — CID 166761430
methyl 2-[5-chloro-2-fluoro-4-[3-(3-methyl-5-methylidenecyclohexyl)propoxy]benzoyl]cyclohexane-1-carboxylate (PubChem CID 166761430) has the molecular formula C26H34ClFO4 and a molecular weight of 465.01 g/mol. Its IUPAC name is methyl 2-[5-chloro-2-fluoro-4-[3-(3-methyl-5-methylidenecyclohexyl)propoxy]benzoyl]cyclohexane-1-carboxylate.
| Compound Name | methyl 2-[5-chloro-2-fluoro-4-[3-(3-methyl-5-methylidenecyclohexyl)propoxy]benzoyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 166761430 |
| Molecular Formula | C26H34ClFO4 |
| Molecular Weight | 465.01 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | methyl 2-[5-chloro-2-fluoro-4-[3-(3-methyl-5-methylidenecyclohexyl)propoxy]benzoyl]cyclohexane-1-carboxylate |
| SMILES | C=C1CC(C)CC(CCCOc2cc(F)c(C(=O)C3CCCCC3C(=O)OC)cc2Cl)C1 |
| InChI | InChI=1S/C26H34ClFO4/c1-16-11-17(2)13-18(12-16)7-6-10-32-24-15-23(28)21(14-22(24)27)25(29)19-8-4-5-9-20(19)26(30)31-3/h14-15,17-20H,1,4-13H2,2-3H3 |
| InChIKey | LLYMLFABHJSMHE-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.01 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|