C22H21ClN4 — CID 166762154
6-(3-chlorophenyl)-N-cyclohexyl-9H-pyrimido[4,5-b]indol-4-amine (PubChem CID 166762154) has the molecular formula C22H21ClN4 and a molecular weight of 376.89 g/mol. Its IUPAC name is 6-(3-chlorophenyl)-N-cyclohexyl-9H-pyrimido[4,5-b]indol-4-amine.
| Compound Name | 6-(3-chlorophenyl)-N-cyclohexyl-9H-pyrimido[4,5-b]indol-4-amine |
|---|---|
| PubChem CID | 166762154 |
| Molecular Formula | C22H21ClN4 |
| Molecular Weight | 376.89 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 6-(3-chlorophenyl)-N-cyclohexyl-9H-pyrimido[4,5-b]indol-4-amine |
| SMILES | Clc1cccc(-c2ccc3[nH]c4ncnc(NC5CCCCC5)c4c3c2)c1 |
| InChI | InChI=1S/C22H21ClN4/c23-16-6-4-5-14(11-16)15-9-10-19-18(12-15)20-21(24-13-25-22(20)27-19)26-17-7-2-1-3-8-17/h4-6,9-13,17H,1-3,7-8H2,(H2,24,25,26,27) |
| InChIKey | DYWCUDKXCRDDKW-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.89 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |