C17H16N2O6 — CID 166763096
N-[3-cyano-4-(2,2-dihydroxyethoxy)phenyl]-2-(dihydroxymethyl)benzamide (PubChem CID 166763096) has the molecular formula C17H16N2O6 and a molecular weight of 344.32 g/mol. Its IUPAC name is N-[3-cyano-4-(2,2-dihydroxyethoxy)phenyl]-2-(dihydroxymethyl)benzamide.
| Compound Name | N-[3-cyano-4-(2,2-dihydroxyethoxy)phenyl]-2-(dihydroxymethyl)benzamide |
|---|---|
| PubChem CID | 166763096 |
| Molecular Formula | C17H16N2O6 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | N-[3-cyano-4-(2,2-dihydroxyethoxy)phenyl]-2-(dihydroxymethyl)benzamide |
| SMILES | N#Cc1cc(NC(=O)c2ccccc2C(O)O)ccc1OCC(O)O |
| InChI | InChI=1S/C17H16N2O6/c18-8-10-7-11(5-6-14(10)25-9-15(20)21)19-16(22)12-3-1-2-4-13(12)17(23)24/h1-7,15,17,20-21,23-24H,9H2,(H,19,22) |
| InChIKey | GQGOSFHTUBSPIU-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 143.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|