C19H14N2O6 — CID 166764984
4-(2-carboxy-5-hydroxy-1H-indol-7-yl)-5-methoxy-1H-indole-2-carboxylic acid (PubChem CID 166764984) has the molecular formula C19H14N2O6 and a molecular weight of 366.33 g/mol. Its IUPAC name is 4-(2-carboxy-5-hydroxy-1H-indol-7-yl)-5-methoxy-1H-indole-2-carboxylic acid.
| Compound Name | 4-(2-carboxy-5-hydroxy-1H-indol-7-yl)-5-methoxy-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 166764984 |
| Molecular Formula | C19H14N2O6 |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 4-(2-carboxy-5-hydroxy-1H-indol-7-yl)-5-methoxy-1H-indole-2-carboxylic acid |
| SMILES | COc1ccc2[nH]c(C(=O)O)cc2c1-c1cc(O)cc2cc(C(=O)O)[nH]c12 |
| InChI | InChI=1S/C19H14N2O6/c1-27-15-3-2-12-10(7-14(20-12)19(25)26)16(15)11-6-9(22)4-8-5-13(18(23)24)21-17(8)11/h2-7,20-22H,1H3,(H,23,24)(H,25,26) |
| InChIKey | DNOSPURDTGXAGV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |