C16H16N3O3S+ — CID 143661049
[3-[2-carboxy-5-methoxy-7-(methylamino)-1H-indol-6-yl]-2-pyridinyl]sulfanium (PubChem CID 143661049) has the molecular formula C16H16N3O3S+ and a molecular weight of 330.39 g/mol. Its IUPAC name is [3-[2-carboxy-5-methoxy-7-(methylamino)-1H-indol-6-yl]-2-pyridinyl]sulfanium.
| Compound Name | [3-[2-carboxy-5-methoxy-7-(methylamino)-1H-indol-6-yl]-2-pyridinyl]sulfanium |
|---|---|
| PubChem CID | 143661049 |
| Molecular Formula | C16H16N3O3S+ |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | [3-[2-carboxy-5-methoxy-7-(methylamino)-1H-indol-6-yl]-2-pyridinyl]sulfanium |
| SMILES | CNc1c(-c2cccnc2[SH2+])c(OC)cc2cc(C(=O)O)[nH]c12 |
| InChI | InChI=1S/C16H15N3O3S/c1-17-14-12(9-4-3-5-18-15(9)23)11(22-2)7-8-6-10(16(20)21)19-13(8)14/h3-7,17,19H,1-2H3,(H,18,23)(H,20,21)/p+1 |
| InChIKey | BFUNGGRIOGVVBS-UHFFFAOYSA-O |
| XLogP | 2.35 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|