C20H28O3 — CID 166765175
3-[2-[3-(cyclohexylmethyl)phenyl]-2-oxoethoxy]-3-methylbutan-2-one (PubChem CID 166765175) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is 3-[2-[3-(cyclohexylmethyl)phenyl]-2-oxoethoxy]-3-methylbutan-2-one.
| Compound Name | 3-[2-[3-(cyclohexylmethyl)phenyl]-2-oxoethoxy]-3-methylbutan-2-one |
|---|---|
| PubChem CID | 166765175 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 3-[2-[3-(cyclohexylmethyl)phenyl]-2-oxoethoxy]-3-methylbutan-2-one |
| SMILES | CC(=O)C(C)(C)OCC(=O)c1cccc(CC2CCCCC2)c1 |
| InChI | InChI=1S/C20H28O3/c1-15(21)20(2,3)23-14-19(22)18-11-7-10-17(13-18)12-16-8-5-4-6-9-16/h7,10-11,13,16H,4-6,8-9,12,14H2,1-3H3 |
| InChIKey | OBQCNKSXDQUKRI-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |