C3H10I2N2P2 — CID 166766113
N,N'-diiodo-N,N'-bis(phosphanyl)propane-1,3-diamine (PubChem CID 166766113) has the molecular formula C3H10I2N2P2 and a molecular weight of 389.88 g/mol. Its IUPAC name is N,N'-diiodo-N,N'-bis(phosphanyl)propane-1,3-diamine.
| Compound Name | N,N'-diiodo-N,N'-bis(phosphanyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 166766113 |
| Molecular Formula | C3H10I2N2P2 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.84 |
| IUPAC Name | N,N'-diiodo-N,N'-bis(phosphanyl)propane-1,3-diamine |
| SMILES | PN(I)CCCN(P)I |
| InChI | InChI=1S/C3H10I2N2P2/c4-6(8)2-1-3-7(5)9/h1-3,8-9H2 |
| InChIKey | RGVOODCNHYCJFY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|