C9H10FIN2O2 — CID 166768637
4-(6-fluoro-4-iodo-2-pyridinyl)morpholin-3-ol (PubChem CID 166768637) has the molecular formula C9H10FIN2O2 and a molecular weight of 324.09 g/mol. Its IUPAC name is 4-(6-fluoro-4-iodo-2-pyridinyl)morpholin-3-ol.
| Compound Name | 4-(6-fluoro-4-iodo-2-pyridinyl)morpholin-3-ol |
|---|---|
| PubChem CID | 166768637 |
| Molecular Formula | C9H10FIN2O2 |
| Molecular Weight | 324.09 g/mol |
| Exact Mass | 323.98 |
| IUPAC Name | 4-(6-fluoro-4-iodo-2-pyridinyl)morpholin-3-ol |
| SMILES | OC1COCCN1c1cc(I)cc(F)n1 |
| InChI | InChI=1S/C9H10FIN2O2/c10-7-3-6(11)4-8(12-7)13-1-2-15-5-9(13)14/h3-4,9,14H,1-2,5H2 |
| InChIKey | AHAMHHZLLDAKOO-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.09 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|