C15H20BrFN2O3 — CID 129248364
tert-butyl 2-[4-(4-bromo-6-fluoro-2-pyridinyl)morpholin-3-yl]acetate (PubChem CID 129248364) has the molecular formula C15H20BrFN2O3 and a molecular weight of 375.24 g/mol. Its IUPAC name is tert-butyl 2-[4-(4-bromo-6-fluoro-2-pyridinyl)morpholin-3-yl]acetate.
| Compound Name | tert-butyl 2-[4-(4-bromo-6-fluoro-2-pyridinyl)morpholin-3-yl]acetate |
|---|---|
| PubChem CID | 129248364 |
| Molecular Formula | C15H20BrFN2O3 |
| Molecular Weight | 375.24 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | tert-butyl 2-[4-(4-bromo-6-fluoro-2-pyridinyl)morpholin-3-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CC1COCCN1c1cc(Br)cc(F)n1 |
| InChI | InChI=1S/C15H20BrFN2O3/c1-15(2,3)22-14(20)8-11-9-21-5-4-19(11)13-7-10(16)6-12(17)18-13/h6-7,11H,4-5,8-9H2,1-3H3 |
| InChIKey | KZFAEVNWHQTKLZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.24 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|