C10HF16IO3 — CID 166769785
formyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-9-iodononanoate (PubChem CID 166769785) has the molecular formula C10HF16IO3 and a molecular weight of 599.99 g/mol. Its IUPAC name is formyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-9-iodononanoate.
| Compound Name | formyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-9-iodononanoate |
|---|---|
| PubChem CID | 166769785 |
| Molecular Formula | C10HF16IO3 |
| Molecular Weight | 599.99 g/mol |
| Exact Mass | 599.87 |
| IUPAC Name | formyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-9-iodononanoate |
| SMILES | O=COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)I |
| InChI | InChI=1S/C10HF16IO3/c11-3(12,2(29)30-1-28)4(13,14)5(15,16)6(17,18)7(19,20)8(21,22)9(23,24)10(25,26)27/h1H |
| InChIKey | IKKCPXQYTKEYIA-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.99 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|