C6H14N2OS — CID 166777810
2-amino-3-methyl-N-methylsulfanylbutanamide (PubChem CID 166777810) has the molecular formula C6H14N2OS and a molecular weight of 162.26 g/mol. Its IUPAC name is 2-amino-3-methyl-N-methylsulfanylbutanamide.
| Compound Name | 2-amino-3-methyl-N-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 166777810 |
| Molecular Formula | C6H14N2OS |
| Molecular Weight | 162.26 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 2-amino-3-methyl-N-methylsulfanylbutanamide |
| SMILES | CSNC(=O)C(N)C(C)C |
| InChI | InChI=1S/C6H14N2OS/c1-4(2)5(7)6(9)8-10-3/h4-5H,7H2,1-3H3,(H,8,9) |
| InChIKey | SQPTZOMNNNDLAW-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.26 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|