C26H36N4O10 — CID 166778044
[2-[[(2S)-4-formyl-6-hydroxy-1,3-dioxan-2-yl]oxy]-4-[4-[[2-[(3S)-2-oxo-3-(propanoylamino)pyrrolidin-1-yl]acetyl]amino]butyl]phenyl]methyl carbamate (PubChem CID 166778044) has the molecular formula C26H36N4O10 and a molecular weight of 564.59 g/mol. Its IUPAC name is [2-[[(2S)-4-formyl-6-hydroxy-1,3-dioxan-2-yl]oxy]-4-[4-[[2-[(3S)-2-oxo-3-(propanoylamino)pyrrolidin-1-yl]acetyl]amino]butyl]phenyl]methyl carbamate.
| Compound Name | [2-[[(2S)-4-formyl-6-hydroxy-1,3-dioxan-2-yl]oxy]-4-[4-[[2-[(3S)-2-oxo-3-(propanoylamino)pyrrolidin-1-yl]acetyl]amino]butyl]phenyl]methyl carbamate |
|---|---|
| PubChem CID | 166778044 |
| Molecular Formula | C26H36N4O10 |
| Molecular Weight | 564.59 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | [2-[[(2S)-4-formyl-6-hydroxy-1,3-dioxan-2-yl]oxy]-4-[4-[[2-[(3S)-2-oxo-3-(propanoylamino)pyrrolidin-1-yl]acetyl]amino]butyl]phenyl]methyl carbamate |
| SMILES | CCC(=O)N[C@H]1CCN(CC(=O)NCCCCc2ccc(COC(N)=O)c(O[C@H]3OC(O)CC(C=O)O3)c2)C1=O |
| InChI | InChI=1S/C26H36N4O10/c1-2-21(32)29-19-8-10-30(24(19)35)13-22(33)28-9-4-3-5-16-6-7-17(15-37-25(27)36)20(11-16)39-26-38-18(14-31)12-23(34)40-26/h6-7,11,14,18-19,23,26,34H,2-5,8-10,12-13,15H2,1H3,(H2,27,36)(H,28,33)(H,29,32)/t18?,19-,23?,26-/m0/s1 |
| InChIKey | RCBUEHICWADVEV-FGDCZJEYSA-N |
| XLogP | -0.17 |
| TPSA | 195.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.59 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|