C13H21N3O3S — CID 166779765
1-(3-butylsulfanylpropyl)-3-prop-2-enyl-1,3,5-triazinane-2,4,6-trione (PubChem CID 166779765) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is 1-(3-butylsulfanylpropyl)-3-prop-2-enyl-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-(3-butylsulfanylpropyl)-3-prop-2-enyl-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 166779765 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 1-(3-butylsulfanylpropyl)-3-prop-2-enyl-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=CCn1c(=O)[nH]c(=O)n(CCCSCCCC)c1=O |
| InChI | InChI=1S/C13H21N3O3S/c1-3-5-9-20-10-6-8-16-12(18)14-11(17)15(7-4-2)13(16)19/h4H,2-3,5-10H2,1H3,(H,14,17,18) |
| InChIKey | LYALLLBMKUWNPA-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 76.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|