C18H20F2N2 — CID 166780331
4-(4-fluoro-N-[(3E)-4-fluoropenta-1,3-dien-2-yl]anilino)-3,3-dimethylpent-4-enenitrile (PubChem CID 166780331) has the molecular formula C18H20F2N2 and a molecular weight of 302.37 g/mol. Its IUPAC name is 4-(4-fluoro-N-[(3E)-4-fluoropenta-1,3-dien-2-yl]anilino)-3,3-dimethylpent-4-enenitrile.
| Compound Name | 4-(4-fluoro-N-[(3E)-4-fluoropenta-1,3-dien-2-yl]anilino)-3,3-dimethylpent-4-enenitrile |
|---|---|
| PubChem CID | 166780331 |
| Molecular Formula | C18H20F2N2 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 4-(4-fluoro-N-[(3E)-4-fluoropenta-1,3-dien-2-yl]anilino)-3,3-dimethylpent-4-enenitrile |
| SMILES | C=C(/C=C(\C)F)N(C(=C)C(C)(C)CC#N)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H20F2N2/c1-13(19)12-14(2)22(15(3)18(4,5)10-11-21)17-8-6-16(20)7-9-17/h6-9,12H,2-3,10H2,1,4-5H3/b13-12+ |
| InChIKey | RHJNYBARQROXMK-OUKQBFOZSA-N |
| XLogP | 5.47 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|