About 2-[5,6-bis(1-cyanoethoxy)hexoxy]propanenitrile
2-[5,6-bis(1-cyanoethoxy)hexoxy]propanenitrile (PubChem CID 166781966) has the molecular formula C15H23N3O3
and a molecular weight of 293.37 g/mol. Its IUPAC name is 2-[5,6-bis(1-cyanoethoxy)hexoxy]propanenitrile.
Molecular Properties
| Compound Name | 2-[5,6-bis(1-cyanoethoxy)hexoxy]propanenitrile |
| PubChem CID | 166781966 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 2-[5,6-bis(1-cyanoethoxy)hexoxy]propanenitrile |
| SMILES | CC(C#N)OCCCCC(COC(C)C#N)OC(C)C#N |
| InChI | InChI=1S/C15H23N3O3/c1-12(8-16)19-7-5-4-6-15(21-14(3)10-18)11-20-13(2)9-17/h12-15H,4-7,11H2,1-3H3 |
| InChIKey | HBSBCZLTIPUSCX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 99.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[5,6-bis(1-cyanoethoxy)hexoxy]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5,6-bis(1-cyanoethoxy)hexoxy]propanenitrile?
The IUPAC name of 2-[5,6-bis(1-cyanoethoxy)hexoxy]propanenitrile (CID 166781966) is 2-[5,6-bis(1-cyanoethoxy)hexoxy]propanenitrile.
What is the SMILES notation for 2-[5,6-bis(1-cyanoethoxy)hexoxy]propanenitrile?
The canonical SMILES for 2-[5,6-bis(1-cyanoethoxy)hexoxy]propanenitrile is CC(C#N)OCCCCC(COC(C)C#N)OC(C)C#N.
What is the InChIKey of 2-[5,6-bis(1-cyanoethoxy)hexoxy]propanenitrile?
The InChIKey is HBSBCZLTIPUSCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3O3/c1-12(8-16)19-7-5-4-6-15(21-14(3)10-18)11-20-13(2)9-17/h12-15H,4-7,11H2,1-3H3.
What are the key properties of 2-[5,6-bis(1-cyanoethoxy)hexoxy]propanenitrile?
2-[5,6-bis(1-cyanoethoxy)hexoxy]propanenitrile has a molecular weight of 293.37 g/mol, XLogP of 2.31, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5,6-bis(1-cyanoethoxy)hexoxy]propanenitrile is sourced from PubChem (CID 166781966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).