C15H23N3O3 — CID 166781966
2-[5,6-bis(1-cyanoethoxy)hexoxy]propanenitrile (PubChem CID 166781966) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is 2-[5,6-bis(1-cyanoethoxy)hexoxy]propanenitrile.
| Compound Name | 2-[5,6-bis(1-cyanoethoxy)hexoxy]propanenitrile |
|---|---|
| PubChem CID | 166781966 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 2-[5,6-bis(1-cyanoethoxy)hexoxy]propanenitrile |
| SMILES | CC(C#N)OCCCCC(COC(C)C#N)OC(C)C#N |
| InChI | InChI=1S/C15H23N3O3/c1-12(8-16)19-7-5-4-6-15(21-14(3)10-18)11-20-13(2)9-17/h12-15H,4-7,11H2,1-3H3 |
| InChIKey | HBSBCZLTIPUSCX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 99.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|