C18H35IN2O2 — CID 166788419
N-[7-[(2-iodoacetyl)amino]-2,6,6-trimethylheptan-2-yl]-3,3-dimethylbutanamide (PubChem CID 166788419) has the molecular formula C18H35IN2O2 and a molecular weight of 438.39 g/mol. Its IUPAC name is N-[7-[(2-iodoacetyl)amino]-2,6,6-trimethylheptan-2-yl]-3,3-dimethylbutanamide.
| Compound Name | N-[7-[(2-iodoacetyl)amino]-2,6,6-trimethylheptan-2-yl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 166788419 |
| Molecular Formula | C18H35IN2O2 |
| Molecular Weight | 438.39 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | N-[7-[(2-iodoacetyl)amino]-2,6,6-trimethylheptan-2-yl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)NC(C)(C)CCCC(C)(C)CNC(=O)CI |
| InChI | InChI=1S/C18H35IN2O2/c1-16(2,3)11-14(22)21-18(6,7)10-8-9-17(4,5)13-20-15(23)12-19/h8-13H2,1-7H3,(H,20,23)(H,21,22) |
| InChIKey | PGVMQBGQVUTLIL-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|