C15H14ClF3N2O3S2 — CID 16678892
1-(3-chloro-4-propylsulfonylthiophen-2-yl)-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 16678892) has the molecular formula C15H14ClF3N2O3S2 and a molecular weight of 426.87 g/mol. Its IUPAC name is 1-(3-chloro-4-propylsulfonylthiophen-2-yl)-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(3-chloro-4-propylsulfonylthiophen-2-yl)-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 16678892 |
| Molecular Formula | C15H14ClF3N2O3S2 |
| Molecular Weight | 426.87 g/mol |
| Exact Mass | 426.01 |
| IUPAC Name | 1-(3-chloro-4-propylsulfonylthiophen-2-yl)-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | CCCS(=O)(=O)c1csc(NC(=O)Nc2cccc(C(F)(F)F)c2)c1Cl |
| InChI | InChI=1S/C15H14ClF3N2O3S2/c1-2-6-26(23,24)11-8-25-13(12(11)16)21-14(22)20-10-5-3-4-9(7-10)15(17,18)19/h3-5,7-8H,2,6H2,1H3,(H2,20,21,22) |
| InChIKey | CHUCLZFYBJEQOM-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.87 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |