C9H18O5P2 — CID 166789825
[(3aR,5R,6S,6aR)-2,2,5-trimethyl-6-phosphanyloxy-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methoxyphosphane (PubChem CID 166789825) has the molecular formula C9H18O5P2 and a molecular weight of 268.19 g/mol. Its IUPAC name is [(3aR,5R,6S,6aR)-2,2,5-trimethyl-6-phosphanyloxy-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methoxyphosphane.
| Compound Name | [(3aR,5R,6S,6aR)-2,2,5-trimethyl-6-phosphanyloxy-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methoxyphosphane |
|---|---|
| PubChem CID | 166789825 |
| Molecular Formula | C9H18O5P2 |
| Molecular Weight | 268.19 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | [(3aR,5R,6S,6aR)-2,2,5-trimethyl-6-phosphanyloxy-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methoxyphosphane |
| SMILES | CC1(C)O[C@H]2O[C@](C)(COP)[C@@H](OP)[C@H]2O1 |
| InChI | InChI=1S/C9H18O5P2/c1-8(2)11-5-6(14-16)9(3,4-10-15)13-7(5)12-8/h5-7H,4,15-16H2,1-3H3/t5-,6+,7+,9-/m1/s1 |
| InChIKey | UTUXNCHTACWQDE-UTSKPXGSSA-N |
| XLogP | 1.23 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.19 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|