C20H27ClF2N2O4S — CID 16679174
2-chloro-N-[[1-ethylsulfonyl-4-(oxolan-2-ylmethyl)piperidin-4-yl]methyl]-3,6-difluorobenzamide (PubChem CID 16679174) has the molecular formula C20H27ClF2N2O4S and a molecular weight of 464.96 g/mol. Its IUPAC name is 2-chloro-N-[[1-ethylsulfonyl-4-(oxolan-2-ylmethyl)piperidin-4-yl]methyl]-3,6-difluorobenzamide.
| Compound Name | 2-chloro-N-[[1-ethylsulfonyl-4-(oxolan-2-ylmethyl)piperidin-4-yl]methyl]-3,6-difluorobenzamide |
|---|---|
| PubChem CID | 16679174 |
| Molecular Formula | C20H27ClF2N2O4S |
| Molecular Weight | 464.96 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 2-chloro-N-[[1-ethylsulfonyl-4-(oxolan-2-ylmethyl)piperidin-4-yl]methyl]-3,6-difluorobenzamide |
| SMILES | CCS(=O)(=O)N1CCC(CNC(=O)c2c(F)ccc(F)c2Cl)(CC2CCCO2)CC1 |
| InChI | InChI=1S/C20H27ClF2N2O4S/c1-2-30(27,28)25-9-7-20(8-10-25,12-14-4-3-11-29-14)13-24-19(26)17-15(22)5-6-16(23)18(17)21/h5-6,14H,2-4,7-13H2,1H3,(H,24,26) |
| InChIKey | WFCFVOMKXMKGTH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.96 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|