C21H29ClF2N2O4S — CID 16679274
2-chloro-N-[[1-ethylsulfonyl-4-(oxan-4-ylmethyl)piperidin-4-yl]methyl]-3,6-difluorobenzamide (PubChem CID 16679274) has the molecular formula C21H29ClF2N2O4S and a molecular weight of 478.99 g/mol. Its IUPAC name is 2-chloro-N-[[1-ethylsulfonyl-4-(oxan-4-ylmethyl)piperidin-4-yl]methyl]-3,6-difluorobenzamide.
| Compound Name | 2-chloro-N-[[1-ethylsulfonyl-4-(oxan-4-ylmethyl)piperidin-4-yl]methyl]-3,6-difluorobenzamide |
|---|---|
| PubChem CID | 16679274 |
| Molecular Formula | C21H29ClF2N2O4S |
| Molecular Weight | 478.99 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 2-chloro-N-[[1-ethylsulfonyl-4-(oxan-4-ylmethyl)piperidin-4-yl]methyl]-3,6-difluorobenzamide |
| SMILES | CCS(=O)(=O)N1CCC(CNC(=O)c2c(F)ccc(F)c2Cl)(CC2CCOCC2)CC1 |
| InChI | InChI=1S/C21H29ClF2N2O4S/c1-2-31(28,29)26-9-7-21(8-10-26,13-15-5-11-30-12-6-15)14-25-20(27)18-16(23)3-4-17(24)19(18)22/h3-4,15H,2,5-14H2,1H3,(H,25,27) |
| InChIKey | YDBCMASJOJCAHW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.99 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|