C52H38N4 — CID 166796379
1-[(Z)-3-phenyl-1-[4-[4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]prop-1-enyl]naphthalen-2-amine (PubChem CID 166796379) has the molecular formula C52H38N4 and a molecular weight of 718.90 g/mol. Its IUPAC name is 1-[(Z)-3-phenyl-1-[4-[4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]prop-1-enyl]naphthalen-2-amine.
| Compound Name | 1-[(Z)-3-phenyl-1-[4-[4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]prop-1-enyl]naphthalen-2-amine |
|---|---|
| PubChem CID | 166796379 |
| Molecular Formula | C52H38N4 |
| Molecular Weight | 718.90 g/mol |
| Exact Mass | 718.31 |
| IUPAC Name | 1-[(Z)-3-phenyl-1-[4-[4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]prop-1-enyl]naphthalen-2-amine |
| SMILES | Nc1ccc2ccccc2c1/C(=C\Cc1ccccc1)c1ccc(-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccc(-c5ccccc5)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C52H38N4/c53-48-35-33-41-16-10-11-19-46(41)49(48)47(34-20-36-12-4-1-5-13-36)42-27-21-39(22-28-42)40-25-31-45(32-26-40)52-55-50(43-17-8-3-9-18-43)54-51(56-52)44-29-23-38(24-30-44)37-14-6-2-7-15-37/h1-19,21-35H,20,53H2/b47-34- |
| InChIKey | PPUMDTFLYCJTOJ-UAAFHFPPSA-N |
| XLogP | 12.62 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.90 |
| LogP ≤ 5 | 12.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|