C16H35N — CID 166808428
N,N,2,4,6,6,7,7-octamethyloctan-2-amine (PubChem CID 166808428) has the molecular formula C16H35N and a molecular weight of 241.46 g/mol. Its IUPAC name is N,N,2,4,6,6,7,7-octamethyloctan-2-amine.
| Compound Name | N,N,2,4,6,6,7,7-octamethyloctan-2-amine |
|---|---|
| PubChem CID | 166808428 |
| Molecular Formula | C16H35N |
| Molecular Weight | 241.46 g/mol |
| Exact Mass | 241.28 |
| IUPAC Name | N,N,2,4,6,6,7,7-octamethyloctan-2-amine |
| SMILES | CC(CC(C)(C)N(C)C)CC(C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H35N/c1-13(12-16(7,8)17(9)10)11-15(5,6)14(2,3)4/h13H,11-12H2,1-10H3 |
| InChIKey | NLNAPKGXALDMDF-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.46 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |